C13H25N3OSi — CID 101246602
[(1S,2S,4R)-2-azido-1-methyl-4-prop-1-en-2-ylcyclohexyl]oxy-trimethylsilane (PubChem CID 101246602) has the molecular formula C13H25N3OSi and a molecular weight of 267.45 g/mol. Its IUPAC name is [(1S,2S,4R)-2-azido-1-methyl-4-prop-1-en-2-ylcyclohexyl]oxy-trimethylsilane.
| Compound Name | [(1S,2S,4R)-2-azido-1-methyl-4-prop-1-en-2-ylcyclohexyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101246602 |
| Molecular Formula | C13H25N3OSi |
| Molecular Weight | 267.45 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [(1S,2S,4R)-2-azido-1-methyl-4-prop-1-en-2-ylcyclohexyl]oxy-trimethylsilane |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O[Si](C)(C)C)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C13H25N3OSi/c1-10(2)11-7-8-13(3,17-18(4,5)6)12(9-11)15-16-14/h11-12H,1,7-9H2,2-6H3/t11-,12+,13+/m1/s1 |
| InChIKey | GVHDUNCSLLDYGA-AGIUHOORSA-N |
| XLogP | 4.65 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|