C13H25N3OSi — CID 102045796
(3-azido-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)oxy-trimethylsilane (PubChem CID 102045796) has the molecular formula C13H25N3OSi and a molecular weight of 267.45 g/mol. Its IUPAC name is (3-azido-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)oxy-trimethylsilane.
| Compound Name | (3-azido-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 102045796 |
| Molecular Formula | C13H25N3OSi |
| Molecular Weight | 267.45 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3-azido-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)oxy-trimethylsilane |
| SMILES | CC1(C)C2CC(N=[N+]=[N-])C(C)(O[Si](C)(C)C)C1C2 |
| InChI | InChI=1S/C13H25N3OSi/c1-12(2)9-7-10(12)13(3,17-18(4,5)6)11(8-9)15-16-14/h9-11H,7-8H2,1-6H3 |
| InChIKey | FEXHSLXYTFPLNE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|