C5H9N3 — CID 134983841
cis-(2S,3S)-2-azido-3-deuterio-1,1-dimethylcyclopropane (PubChem CID 134983841) has the molecular formula C5H9N3 and a molecular weight of 112.15 g/mol. Its IUPAC name is cis-(2S,3S)-2-azido-3-deuterio-1,1-dimethylcyclopropane.
| Compound Name | cis-(2S,3S)-2-azido-3-deuterio-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 134983841 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 112.15 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | cis-(2S,3S)-2-azido-3-deuterio-1,1-dimethylcyclopropane |
| SMILES | [2H][C@@H]1[C@H](N=[N+]=[N-])C1(C)C |
| InChI | InChI=1S/C5H9N3/c1-5(2)3-4(5)7-8-6/h4H,3H2,1-2H3/t4-/m0/s1/i3D/t3-,4+/m1 |
| InChIKey | WWVNZRKXICYPTR-ITEPJMEFSA-N |
| XLogP | 2.10 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|