C8H11N3O2 — CID 132544840
2-azido-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 132544840) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-azido-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-azido-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 132544840 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-azido-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(N=[N+]=[N-])C(=O)C1 |
| InChI | InChI=1S/C8H11N3O2/c1-8(2)3-5(12)7(10-11-9)6(13)4-8/h7H,3-4H2,1-2H3 |
| InChIKey | ADXMYMVLJCXVGF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|