C18H26O2 — CID 12021695
2-(1-adamantyl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 12021695) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-(1-adamantyl)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(1-adamantyl)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 12021695 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-(1-adamantyl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C23CC4CC(CC(C4)C2)C3)C(=O)C1 |
| InChI | InChI=1S/C18H26O2/c1-17(2)9-14(19)16(15(20)10-17)18-6-11-3-12(7-18)5-13(4-11)8-18/h11-13,16H,3-10H2,1-2H3 |
| InChIKey | SRYYJJVXMZRTNX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|