C10H15NO3 — CID 3555444
1-(4,4-dimethyl-2,6-dioxocyclohexyl)-N-methylmethanimine oxide (PubChem CID 3555444) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2,6-dioxocyclohexyl)-N-methylmethanimine oxide.
| Compound Name | 1-(4,4-dimethyl-2,6-dioxocyclohexyl)-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 3555444 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-(4,4-dimethyl-2,6-dioxocyclohexyl)-N-methylmethanimine oxide |
| SMILES | C[N+]([O-])=CC1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C10H15NO3/c1-10(2)4-8(12)7(6-11(3)14)9(13)5-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | NZQFJDBNSOOVFT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|