About 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one
4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one (PubChem CID 78130764) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one.
Analyze 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one?
The IUPAC name of 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one (CID 78130764) is 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one.
What is the SMILES notation for 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one?
The canonical SMILES for 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one is CCN1CC2C3CC4CC(C3)CC2(CC1=O)C4.
What is the InChIKey of 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one?
The InChIKey is VZZHQSFZOHNJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-2-16-9-13-12-4-10-3-11(5-12)7-15(13,6-10)8-14(16)17/h10-13H,2-9H2,1H3.
What are the key properties of 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one?
4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one has a molecular weight of 233.35 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-azatetracyclo[7.3.1.17,11.01,6]tetradecan-3-one is sourced from PubChem (CID 78130764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).