C10H18N2O2S — CID 173202897
4-ethyl-7,7-dimethyl-5-oxo-1,4-thiazepane-2-carboxamide (PubChem CID 173202897) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 4-ethyl-7,7-dimethyl-5-oxo-1,4-thiazepane-2-carboxamide.
| Compound Name | 4-ethyl-7,7-dimethyl-5-oxo-1,4-thiazepane-2-carboxamide |
|---|---|
| PubChem CID | 173202897 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-ethyl-7,7-dimethyl-5-oxo-1,4-thiazepane-2-carboxamide |
| SMILES | CCN1CC(C(N)=O)SC(C)(C)CC1=O |
| InChI | InChI=1S/C10H18N2O2S/c1-4-12-6-7(9(11)14)15-10(2,3)5-8(12)13/h7H,4-6H2,1-3H3,(H2,11,14) |
| InChIKey | QFTGXAMDJWQSIY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |