C7H14N4OS — CID 130847134
1-amino-3-(1-ethyl-5-oxopyrrolidin-3-yl)thiourea (PubChem CID 130847134) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 1-amino-3-(1-ethyl-5-oxopyrrolidin-3-yl)thiourea.
| Compound Name | 1-amino-3-(1-ethyl-5-oxopyrrolidin-3-yl)thiourea |
|---|---|
| PubChem CID | 130847134 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-amino-3-(1-ethyl-5-oxopyrrolidin-3-yl)thiourea |
| SMILES | CCN1CC(NC(=S)NN)CC1=O |
| InChI | InChI=1S/C7H14N4OS/c1-2-11-4-5(3-6(11)12)9-7(13)10-8/h5H,2-4,8H2,1H3,(H2,9,10,13) |
| InChIKey | TVQUEDHIZKYSGF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|