C20H22N2O2 — CID 136546634
N-(1-ethyl-5-oxopyrrolidin-3-yl)-2,2-diphenylacetamide (PubChem CID 136546634) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(1-ethyl-5-oxopyrrolidin-3-yl)-2,2-diphenylacetamide.
| Compound Name | N-(1-ethyl-5-oxopyrrolidin-3-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 136546634 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-(1-ethyl-5-oxopyrrolidin-3-yl)-2,2-diphenylacetamide |
| SMILES | CCN1CC(NC(=O)C(c2ccccc2)c2ccccc2)CC1=O |
| InChI | InChI=1S/C20H22N2O2/c1-2-22-14-17(13-18(22)23)21-20(24)19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,19H,2,13-14H2,1H3,(H,21,24) |
| InChIKey | PWXPUWPNOAMTGT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |