C8H13NO2 — CID 14800179
1-ethyl-5-methylpiperidine-2,4-dione (PubChem CID 14800179) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-ethyl-5-methylpiperidine-2,4-dione.
| Compound Name | 1-ethyl-5-methylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 14800179 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 1-ethyl-5-methylpiperidine-2,4-dione |
| SMILES | CCN1CC(C)C(=O)CC1=O |
| InChI | InChI=1S/C8H13NO2/c1-3-9-5-6(2)7(10)4-8(9)11/h6H,3-5H2,1-2H3 |
| InChIKey | RLBLBEYGKCDKQZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|