About 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one
3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one (PubChem CID 557465) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one.
Analyze 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one?
The IUPAC name of 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one (CID 557465) is 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one.
What is the SMILES notation for 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one?
The canonical SMILES for 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one is CCN1CC2CCC(CC1=O)N2C.
What is the InChIKey of 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one?
The InChIKey is XECFPKLAZCAOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-12-7-9-5-4-8(11(9)2)6-10(12)13/h8-9H,3-7H2,1-2H3.
What are the key properties of 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one?
3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one has a molecular weight of 182.27 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one is sourced from PubChem (CID 557465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).