C8H16N2O — CID 156824665
1-ethyl-4,5-dimethylpiperazin-2-one (PubChem CID 156824665) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-ethyl-4,5-dimethylpiperazin-2-one.
| Compound Name | 1-ethyl-4,5-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 156824665 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-ethyl-4,5-dimethylpiperazin-2-one |
| SMILES | CCN1CC(C)N(C)CC1=O |
| InChI | InChI=1S/C8H16N2O/c1-4-10-5-7(2)9(3)6-8(10)11/h7H,4-6H2,1-3H3 |
| InChIKey | IQNVDRYIEQMYQA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |