C8H11N2O2+ — CID 170919696
4,4-dimethyl-2,6-dioxocyclohexane-1-diazonium (PubChem CID 170919696) has the molecular formula C8H11N2O2+ and a molecular weight of 167.19 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-dioxocyclohexane-1-diazonium.
| Compound Name | 4,4-dimethyl-2,6-dioxocyclohexane-1-diazonium |
|---|---|
| PubChem CID | 170919696 |
| Molecular Formula | C8H11N2O2+ |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 4,4-dimethyl-2,6-dioxocyclohexane-1-diazonium |
| SMILES | CC1(C)CC(=O)C([N+]#N)C(=O)C1 |
| InChI | InChI=1S/C8H11N2O2/c1-8(2)3-5(11)7(10-9)6(12)4-8/h7H,3-4H2,1-2H3/q+1 |
| InChIKey | SLSQTKDIPZHTOF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|