C16H26O4S — CID 68519610
bis(5,5-dimethylcyclohexane-1,3-dione);sulfane (PubChem CID 68519610) has the molecular formula C16H26O4S and a molecular weight of 314.45 g/mol. Its IUPAC name is bis(5,5-dimethylcyclohexane-1,3-dione);sulfane.
| Compound Name | bis(5,5-dimethylcyclohexane-1,3-dione);sulfane |
|---|---|
| PubChem CID | 68519610 |
| Molecular Formula | C16H26O4S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | bis(5,5-dimethylcyclohexane-1,3-dione);sulfane |
| SMILES | CC1(C)CC(=O)CC(=O)C1.CC1(C)CC(=O)CC(=O)C1.S |
| InChI | InChI=1S/2C8H12O2.H2S/c2*1-8(2)4-6(9)3-7(10)5-8;/h2*3-5H2,1-2H3;1H2 |
| InChIKey | MCIUCBYJKZONSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|