About bis(5,5-dimethylcyclohexane-1,3-dione);sulfane
bis(5,5-dimethylcyclohexane-1,3-dione);sulfane (PubChem CID 68519610) has the molecular formula C16H26O4S
and a molecular weight of 314.45 g/mol. Its IUPAC name is bis(5,5-dimethylcyclohexane-1,3-dione);sulfane.
Molecular Properties
| Compound Name | bis(5,5-dimethylcyclohexane-1,3-dione);sulfane |
| PubChem CID | 68519610 |
| Molecular Formula | C16H26O4S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | bis(5,5-dimethylcyclohexane-1,3-dione);sulfane |
| SMILES | CC1(C)CC(=O)CC(=O)C1.CC1(C)CC(=O)CC(=O)C1.S |
| InChI | InChI=1S/2C8H12O2.H2S/c2*1-8(2)4-6(9)3-7(10)5-8;/h2*3-5H2,1-2H3;1H2 |
| InChIKey | MCIUCBYJKZONSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(5,5-dimethylcyclohexane-1,3-dione);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5,5-dimethylcyclohexane-1,3-dione);sulfane?
The IUPAC name of bis(5,5-dimethylcyclohexane-1,3-dione);sulfane (CID 68519610) is bis(5,5-dimethylcyclohexane-1,3-dione);sulfane.
What is the SMILES notation for bis(5,5-dimethylcyclohexane-1,3-dione);sulfane?
The canonical SMILES for bis(5,5-dimethylcyclohexane-1,3-dione);sulfane is CC1(C)CC(=O)CC(=O)C1.CC1(C)CC(=O)CC(=O)C1.S.
What is the InChIKey of bis(5,5-dimethylcyclohexane-1,3-dione);sulfane?
The InChIKey is MCIUCBYJKZONSD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H12O2.H2S/c2*1-8(2)4-6(9)3-7(10)5-8;/h2*3-5H2,1-2H3;1H2.
What are the key properties of bis(5,5-dimethylcyclohexane-1,3-dione);sulfane?
bis(5,5-dimethylcyclohexane-1,3-dione);sulfane has a molecular weight of 314.45 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5,5-dimethylcyclohexane-1,3-dione);sulfane is sourced from PubChem (CID 68519610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).