C24H30O8 — CID 163045638
cis-(4S,6R)-4-butanoyl-6-[[(1R,3R,5R)-3-butanoyl-5-methyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione (PubChem CID 163045638) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is cis-(4S,6R)-4-butanoyl-6-[[(1R,3R,5R)-3-butanoyl-5-methyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione.
| Compound Name | cis-(4S,6R)-4-butanoyl-6-[[(1R,3R,5R)-3-butanoyl-5-methyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 163045638 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | cis-(4S,6R)-4-butanoyl-6-[[(1R,3R,5R)-3-butanoyl-5-methyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
| SMILES | CCCC(=O)[C@@H]1C(=O)[C@H](C)C(=O)[C@@H](C[C@@H]2C(=O)[C@H](C(=O)CCC)C(=O)C(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C24H30O8/c1-6-8-14(25)16-19(28)11(3)18(27)12(20(16)29)10-13-21(30)17(15(26)9-7-2)23(32)24(4,5)22(13)31/h11-13,16-17H,6-10H2,1-5H3/t11-,12-,13-,16-,17+/m1/s1 |
| InChIKey | ZJHRUSPPIPIFIA-USXSHJJOSA-N |
| XLogP | 1.68 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|