C13H22O2 — CID 165474349
7-butanoyl-2,2-dimethylcycloheptan-1-one (PubChem CID 165474349) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 7-butanoyl-2,2-dimethylcycloheptan-1-one.
| Compound Name | 7-butanoyl-2,2-dimethylcycloheptan-1-one |
|---|---|
| PubChem CID | 165474349 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 7-butanoyl-2,2-dimethylcycloheptan-1-one |
| SMILES | CCCC(=O)C1CCCCC(C)(C)C1=O |
| InChI | InChI=1S/C13H22O2/c1-4-7-11(14)10-8-5-6-9-13(2,3)12(10)15/h10H,4-9H2,1-3H3 |
| InChIKey | UXRZNZYHKKKLLB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|