About 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one
6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one (PubChem CID 130128340) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one |
| PubChem CID | 130128340 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCCC(C(O)CO)C1=O |
| InChI | InChI=1S/C10H18O3/c1-10(2)5-3-4-7(9(10)13)8(12)6-11/h7-8,11-12H,3-6H2,1-2H3 |
| InChIKey | XVQANYQPLZPJFN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one?
The IUPAC name of 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one (CID 130128340) is 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one.
What is the SMILES notation for 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one?
The canonical SMILES for 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one is CC1(C)CCCC(C(O)CO)C1=O.
What is the InChIKey of 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one?
The InChIKey is XVQANYQPLZPJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-10(2)5-3-4-7(9(10)13)8(12)6-11/h7-8,11-12H,3-6H2,1-2H3.
What are the key properties of 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one?
6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one has a molecular weight of 186.25 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one is sourced from PubChem (CID 130128340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).