C10H18O3 — CID 130128340
6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one (PubChem CID 130128340) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one.
| Compound Name | 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 130128340 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 6-(1,2-dihydroxyethyl)-2,2-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCCC(C(O)CO)C1=O |
| InChI | InChI=1S/C10H18O3/c1-10(2)5-3-4-7(9(10)13)8(12)6-11/h7-8,11-12H,3-6H2,1-2H3 |
| InChIKey | XVQANYQPLZPJFN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |