C13H18Cl2O3 — CID 98392613
trans-(4R,6R)-4,6-dichloro-5,5-dimethyl-2-pentanoylcyclohexane-1,3-dione (PubChem CID 98392613) has the molecular formula C13H18Cl2O3 and a molecular weight of 293.19 g/mol. Its IUPAC name is trans-(4R,6R)-4,6-dichloro-5,5-dimethyl-2-pentanoylcyclohexane-1,3-dione.
| Compound Name | trans-(4R,6R)-4,6-dichloro-5,5-dimethyl-2-pentanoylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 98392613 |
| Molecular Formula | C13H18Cl2O3 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | trans-(4R,6R)-4,6-dichloro-5,5-dimethyl-2-pentanoylcyclohexane-1,3-dione |
| SMILES | CCCCC(=O)C1C(=O)[C@H](Cl)C(C)(C)[C@@H](Cl)C1=O |
| InChI | InChI=1S/C13H18Cl2O3/c1-4-5-6-7(16)8-9(17)11(14)13(2,3)12(15)10(8)18/h8,11-12H,4-6H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | UKAAYCSISHDROO-RYUDHWBXSA-N |
| XLogP | 2.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|