C32H46Cl4O6 — CID 88605624
(5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carbonyl) 5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carboperoxoate (PubChem CID 88605624) has the molecular formula C32H46Cl4O6 and a molecular weight of 668.53 g/mol. Its IUPAC name is (5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carbonyl) 5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carboperoxoate.
| Compound Name | (5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carbonyl) 5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carboperoxoate |
|---|---|
| PubChem CID | 88605624 |
| Molecular Formula | C32H46Cl4O6 |
| Molecular Weight | 668.53 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | (5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carbonyl) 5,6-dichloro-4-hexanoyl-3,3,5-trimethylcyclohexene-1-carboperoxoate |
| SMILES | CCCCCC(=O)C1C(C)(C)C=C(C(=O)OOC(=O)C2=CC(C)(C)C(C(=O)CCCCC)C(C)(Cl)C2Cl)C(Cl)C1(C)Cl |
| InChI | InChI=1S/C32H46Cl4O6/c1-9-11-13-15-21(37)23-29(3,4)17-19(25(33)31(23,7)35)27(39)41-42-28(40)20-18-30(5,6)24(32(8,36)26(20)34)22(38)16-14-12-10-2/h17-18,23-26H,9-16H2,1-8H3 |
| InChIKey | OTVNGIGBCCCMQG-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.53 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|