C16H24O4 — CID 68544123
4-hexanoyloxy-2,6,6-trimethylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 68544123) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-hexanoyloxy-2,6,6-trimethylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-hexanoyloxy-2,6,6-trimethylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 68544123 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-hexanoyloxy-2,6,6-trimethylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCCC(=O)OC1=CC(C)(C)C(C(=O)O)C(C)=C1 |
| InChI | InChI=1S/C16H24O4/c1-5-6-7-8-13(17)20-12-9-11(2)14(15(18)19)16(3,4)10-12/h9-10,14H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | FFBPHLHXNGSTHD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|