C21H30O5S — CID 174753403
benzenesulfonic acid;(3,3,5-trimethylcyclohexa-1,5-dien-1-yl) hexanoate (PubChem CID 174753403) has the molecular formula C21H30O5S and a molecular weight of 394.53 g/mol. Its IUPAC name is benzenesulfonic acid;(3,3,5-trimethylcyclohexa-1,5-dien-1-yl) hexanoate.
| Compound Name | benzenesulfonic acid;(3,3,5-trimethylcyclohexa-1,5-dien-1-yl) hexanoate |
|---|---|
| PubChem CID | 174753403 |
| Molecular Formula | C21H30O5S |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | benzenesulfonic acid;(3,3,5-trimethylcyclohexa-1,5-dien-1-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1=CC(C)(C)CC(C)=C1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C15H24O2.C6H6O3S/c1-5-6-7-8-14(16)17-13-9-12(2)10-15(3,4)11-13;7-10(8,9)6-4-2-1-3-5-6/h9,11H,5-8,10H2,1-4H3;1-5H,(H,7,8,9) |
| InChIKey | KZUVNXRIKAMVEW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|