C18H31NO3 — CID 123388577
1-(2,5-dihydroxypyrrol-1-yl)tetradecan-1-one (PubChem CID 123388577) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)tetradecan-1-one.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)tetradecan-1-one |
|---|---|
| PubChem CID | 123388577 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)tetradecan-1-one |
| SMILES | CCCCCCCCCCCCCC(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C18H31NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(20)19-17(21)14-15-18(19)22/h14-15,21-22H,2-13H2,1H3 |
| InChIKey | XFDYGAAQVSZGPO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|