C11H17NO3 — CID 91494577
7-(2,5-dihydroxypyrrol-1-yl)heptan-2-one (PubChem CID 91494577) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 7-(2,5-dihydroxypyrrol-1-yl)heptan-2-one.
| Compound Name | 7-(2,5-dihydroxypyrrol-1-yl)heptan-2-one |
|---|---|
| PubChem CID | 91494577 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 7-(2,5-dihydroxypyrrol-1-yl)heptan-2-one |
| SMILES | CC(=O)CCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C11H17NO3/c1-9(13)5-3-2-4-8-12-10(14)6-7-11(12)15/h6-7,14-15H,2-5,8H2,1H3 |
| InChIKey | NUCBCASCYRCKTH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|