C16H20N2O6 — CID 91373414
1,8-bis(2,5-dihydroxypyrrol-1-yl)octane-2,7-dione (PubChem CID 91373414) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1,8-bis(2,5-dihydroxypyrrol-1-yl)octane-2,7-dione.
| Compound Name | 1,8-bis(2,5-dihydroxypyrrol-1-yl)octane-2,7-dione |
|---|---|
| PubChem CID | 91373414 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1,8-bis(2,5-dihydroxypyrrol-1-yl)octane-2,7-dione |
| SMILES | O=C(CCCCC(=O)Cn1c(O)ccc1O)Cn1c(O)ccc1O |
| InChI | InChI=1S/C16H20N2O6/c19-11(9-17-13(21)5-6-14(17)22)3-1-2-4-12(20)10-18-15(23)7-8-16(18)24/h5-8,21-24H,1-4,9-10H2 |
| InChIKey | VQVOZNNNJAAOIS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|