C7H8BrNO3 — CID 91159484
1-bromo-3-(2,5-dihydroxypyrrol-1-yl)propan-2-one (PubChem CID 91159484) has the molecular formula C7H8BrNO3 and a molecular weight of 234.05 g/mol. Its IUPAC name is 1-bromo-3-(2,5-dihydroxypyrrol-1-yl)propan-2-one.
| Compound Name | 1-bromo-3-(2,5-dihydroxypyrrol-1-yl)propan-2-one |
|---|---|
| PubChem CID | 91159484 |
| Molecular Formula | C7H8BrNO3 |
| Molecular Weight | 234.05 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | 1-bromo-3-(2,5-dihydroxypyrrol-1-yl)propan-2-one |
| SMILES | O=C(CBr)Cn1c(O)ccc1O |
| InChI | InChI=1S/C7H8BrNO3/c8-3-5(10)4-9-6(11)1-2-7(9)12/h1-2,11-12H,3-4H2 |
| InChIKey | XIYAYXXQWMUWAK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.05 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|