C8H9NO5S — CID 57222363
4-(2,5-dihydroxypyrrol-1-yl)-3-oxo-2-sulfanylbutanoic acid (PubChem CID 57222363) has the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)-3-oxo-2-sulfanylbutanoic acid.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)-3-oxo-2-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57222363 |
| Molecular Formula | C8H9NO5S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)-3-oxo-2-sulfanylbutanoic acid |
| SMILES | O=C(O)C(S)C(=O)Cn1c(O)ccc1O |
| InChI | InChI=1S/C8H9NO5S/c10-4(7(15)8(13)14)3-9-5(11)1-2-6(9)12/h1-2,7,11-12,15H,3H2,(H,13,14) |
| InChIKey | AOTATGHBFCMBNH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|