C22H29N3O6S — CID 90685363
(2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 90685363) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90685363 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CNCCCC(=O)[C@@H](S)CCn1c(O)ccc1O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H29N3O6S/c26-17(18(32)10-12-25-20(28)8-9-21(25)29)7-4-11-23-14-19(27)24-16(22(30)31)13-15-5-2-1-3-6-15/h1-3,5-6,8-9,16,18,23,28-29,32H,4,7,10-14H2,(H,24,27)(H,30,31)/t16-,18-/m0/s1 |
| InChIKey | LQPLKPKVXRASMU-WMZOPIPTSA-N |
| XLogP | 1.34 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|