C8H12BrNO2 — CID 54510028
1-(4-bromobutyl)pyrrole-2,5-diol (PubChem CID 54510028) has the molecular formula C8H12BrNO2 and a molecular weight of 234.09 g/mol. Its IUPAC name is 1-(4-bromobutyl)pyrrole-2,5-diol.
| Compound Name | 1-(4-bromobutyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54510028 |
| Molecular Formula | C8H12BrNO2 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 1-(4-bromobutyl)pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCCCBr |
| InChI | InChI=1S/C8H12BrNO2/c9-5-1-2-6-10-7(11)3-4-8(10)12/h3-4,11-12H,1-2,5-6H2 |
| InChIKey | YILJVGGNFGUBPW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|