C13H23NO2 — CID 54200108
1-nonylpyrrole-2,5-diol (PubChem CID 54200108) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-nonylpyrrole-2,5-diol.
| Compound Name | 1-nonylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54200108 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-nonylpyrrole-2,5-diol |
| SMILES | CCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C13H23NO2/c1-2-3-4-5-6-7-8-11-14-12(15)9-10-13(14)16/h9-10,15-16H,2-8,11H2,1H3 |
| InChIKey | POPZFQPKVPWQHF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|