C23H44N2O3 — CID 54266593
1-[10-hydroxy-11-(octylamino)undecyl]pyrrole-2,5-diol (PubChem CID 54266593) has the molecular formula C23H44N2O3 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-[10-hydroxy-11-(octylamino)undecyl]pyrrole-2,5-diol.
| Compound Name | 1-[10-hydroxy-11-(octylamino)undecyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54266593 |
| Molecular Formula | C23H44N2O3 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | 1-[10-hydroxy-11-(octylamino)undecyl]pyrrole-2,5-diol |
| SMILES | CCCCCCCCNCC(O)CCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C23H44N2O3/c1-2-3-4-5-10-13-18-24-20-21(26)15-12-9-7-6-8-11-14-19-25-22(27)16-17-23(25)28/h16-17,21,24,26-28H,2-15,18-20H2,1H3 |
| InChIKey | RHEGKGPNOMPVIU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|