C10H17NO2 — CID 54126791
1-hexylpyrrole-2,5-diol (PubChem CID 54126791) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-hexylpyrrole-2,5-diol.
| Compound Name | 1-hexylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54126791 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-hexylpyrrole-2,5-diol |
| SMILES | CCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C10H17NO2/c1-2-3-4-5-8-11-9(12)6-7-10(11)13/h6-7,12-13H,2-5,8H2,1H3 |
| InChIKey | NRNHTRFQLXKPAK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|