C17H34N2O2Si2 — CID 91348979
1-[3-(2,2,5,5-tetraethyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-diol (PubChem CID 91348979) has the molecular formula C17H34N2O2Si2 and a molecular weight of 354.64 g/mol. Its IUPAC name is 1-[3-(2,2,5,5-tetraethyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-diol.
| Compound Name | 1-[3-(2,2,5,5-tetraethyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91348979 |
| Molecular Formula | C17H34N2O2Si2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-[3-(2,2,5,5-tetraethyl-1,2,5-azadisilolidin-1-yl)propyl]pyrrole-2,5-diol |
| SMILES | CC[Si]1(CC)CC[Si](CC)(CC)N1CCCn1c(O)ccc1O |
| InChI | InChI=1S/C17H34N2O2Si2/c1-5-22(6-2)14-15-23(7-3,8-4)19(22)13-9-12-18-16(20)10-11-17(18)21/h10-11,20-21H,5-9,12-15H2,1-4H3 |
| InChIKey | LTDKQIUMTQYLBD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|