C18H28N2O4 — CID 54293191
1-[10-(2,5-dihydroxypyrrol-1-yl)decyl]pyrrole-2,5-diol (PubChem CID 54293191) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-[10-(2,5-dihydroxypyrrol-1-yl)decyl]pyrrole-2,5-diol.
| Compound Name | 1-[10-(2,5-dihydroxypyrrol-1-yl)decyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54293191 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[10-(2,5-dihydroxypyrrol-1-yl)decyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CCCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C18H28N2O4/c21-15-9-10-16(22)19(15)13-7-5-3-1-2-4-6-8-14-20-17(23)11-12-18(20)24/h9-12,21-24H,1-8,13-14H2 |
| InChIKey | RYYUJTAIEBIMIJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|