C9H14BrNO2S — CID 91455730
3-(6-bromohexyl)-4-hydroxy-1,3-thiazol-2-one (PubChem CID 91455730) has the molecular formula C9H14BrNO2S and a molecular weight of 280.19 g/mol. Its IUPAC name is 3-(6-bromohexyl)-4-hydroxy-1,3-thiazol-2-one.
| Compound Name | 3-(6-bromohexyl)-4-hydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91455730 |
| Molecular Formula | C9H14BrNO2S |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3-(6-bromohexyl)-4-hydroxy-1,3-thiazol-2-one |
| SMILES | O=c1scc(O)n1CCCCCCBr |
| InChI | InChI=1S/C9H14BrNO2S/c10-5-3-1-2-4-6-11-8(12)7-14-9(11)13/h7,12H,1-6H2 |
| InChIKey | VVTLLERXRFUODU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|