C17H14N2O3S — CID 91001525
4-[(4-hydroxy-2-oxo-1,3-thiazol-3-yl)methyl]-N-phenylbenzamide (PubChem CID 91001525) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-[(4-hydroxy-2-oxo-1,3-thiazol-3-yl)methyl]-N-phenylbenzamide.
| Compound Name | 4-[(4-hydroxy-2-oxo-1,3-thiazol-3-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 91001525 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-[(4-hydroxy-2-oxo-1,3-thiazol-3-yl)methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(Cn2c(O)csc2=O)cc1 |
| InChI | InChI=1S/C17H14N2O3S/c20-15-11-23-17(22)19(15)10-12-6-8-13(9-7-12)16(21)18-14-4-2-1-3-5-14/h1-9,11,20H,10H2,(H,18,21) |
| InChIKey | OCDVJLRVESLSLG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |