C11H17NO2S2 — CID 57280249
1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)octan-1-one (PubChem CID 57280249) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)octan-1-one.
| Compound Name | 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)octan-1-one |
|---|---|
| PubChem CID | 57280249 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)n1c(O)csc1=S |
| InChI | InChI=1S/C11H17NO2S2/c1-2-3-4-5-6-7-9(13)12-10(14)8-16-11(12)15/h8,14H,2-7H2,1H3 |
| InChIKey | NAXPZBWIDBKKEQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|