C17H29NO2S2 — CID 71421181
2-sulfanylidene-3-tetradecanoyl-1,3-thiazolidin-4-one (PubChem CID 71421181) has the molecular formula C17H29NO2S2 and a molecular weight of 343.56 g/mol. Its IUPAC name is 2-sulfanylidene-3-tetradecanoyl-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-3-tetradecanoyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71421181 |
| Molecular Formula | C17H29NO2S2 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-sulfanylidene-3-tetradecanoyl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCCCCCCC(=O)N1C(=O)CSC1=S |
| InChI | InChI=1S/C17H29NO2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(19)18-16(20)14-22-17(18)21/h2-14H2,1H3 |
| InChIKey | CDASZEZYQUJTLG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|