C14H21N3OS3 — CID 11067894
4-hydroxy-3-(5-nonyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-2-thione (PubChem CID 11067894) has the molecular formula C14H21N3OS3 and a molecular weight of 343.54 g/mol. Its IUPAC name is 4-hydroxy-3-(5-nonyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-3-(5-nonyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 11067894 |
| Molecular Formula | C14H21N3OS3 |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-hydroxy-3-(5-nonyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-2-thione |
| SMILES | CCCCCCCCCc1nnc(-n2c(O)csc2=S)s1 |
| InChI | InChI=1S/C14H21N3OS3/c1-2-3-4-5-6-7-8-9-11-15-16-13(21-11)17-12(18)10-20-14(17)19/h10,18H,2-9H2,1H3 |
| InChIKey | SXWJSHDZFISXBF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|