C41H55N5S2Sn — CID 15970553
4-(5-decyl-1,3,4-thiadiazol-2-yl)-5-hexyl-1,2,4-triazole-3-thiolate;tribenzylstannanylium (PubChem CID 15970553) has the molecular formula C41H55N5S2Sn and a molecular weight of 800.77 g/mol. Its IUPAC name is 4-(5-decyl-1,3,4-thiadiazol-2-yl)-5-hexyl-1,2,4-triazole-3-thiolate;tribenzylstannanylium.
| Compound Name | 4-(5-decyl-1,3,4-thiadiazol-2-yl)-5-hexyl-1,2,4-triazole-3-thiolate;tribenzylstannanylium |
|---|---|
| PubChem CID | 15970553 |
| Molecular Formula | C41H55N5S2Sn |
| Molecular Weight | 800.77 g/mol |
| Exact Mass | 801.29 |
| IUPAC Name | 4-(5-decyl-1,3,4-thiadiazol-2-yl)-5-hexyl-1,2,4-triazole-3-thiolate;tribenzylstannanylium |
| SMILES | CCCCCCCCCCc1nnc(-n2c([S-])nnc2CCCCCC)s1.c1ccc(C[Sn+](Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H35N5S2.3C7H7.Sn/c1-3-5-7-9-10-11-12-14-16-18-22-24-20(27-18)25-17(21-23-19(25)26)15-13-8-6-4-2;3*1-7-5-3-2-4-6-7;/h3-16H2,1-2H3,(H,23,26);3*2-6H,1H2;/q;;;;+1/p-1 |
| InChIKey | COEDWSYZYABDHF-UHFFFAOYSA-M |
| XLogP | 10.66 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.77 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|