C13H19N3O3 — CID 162420861
2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 162420861) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 162420861 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(=C(O)CCCCN=[N+]=[N-])C(=O)C1 |
| InChI | InChI=1S/C13H19N3O3/c1-13(2)7-10(18)12(11(19)8-13)9(17)5-3-4-6-15-16-14/h17H,3-8H2,1-2H3 |
| InChIKey | QJAIZMFMRIWAOC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|