C26H36N2O8 — CID 135838661
3-[[(2E)-2-[(4E)-4-[2-(2-carboxyethylimino)-4,4-dimethyl-6-oxocyclohexylidene]-1,4-dihydroxybutylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid (PubChem CID 135838661) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is 3-[[(2E)-2-[(4E)-4-[2-(2-carboxyethylimino)-4,4-dimethyl-6-oxocyclohexylidene]-1,4-dihydroxybutylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid.
| Compound Name | 3-[[(2E)-2-[(4E)-4-[2-(2-carboxyethylimino)-4,4-dimethyl-6-oxocyclohexylidene]-1,4-dihydroxybutylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 135838661 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 3-[[(2E)-2-[(4E)-4-[2-(2-carboxyethylimino)-4,4-dimethyl-6-oxocyclohexylidene]-1,4-dihydroxybutylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid |
| SMILES | CC1(C)CC(=O)C(=C(/O)CC/C(O)=C2\C(=O)CC(C)(C)C\C2=N/CCC(=O)O)/C(=N/CCC(=O)O)C1 |
| InChI | InChI=1S/C26H36N2O8/c1-25(2)11-15(27-9-7-21(33)34)23(19(31)13-25)17(29)5-6-18(30)24-16(28-10-8-22(35)36)12-26(3,4)14-20(24)32/h29-30H,5-14H2,1-4H3,(H,33,34)(H,35,36)/b23-17+,24-18+,27-15+,28-16+ |
| InChIKey | ZMGLLMVYQQPRKH-BNQFTWKWSA-N |
| XLogP | 4.00 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|