C32H48N2O8 — CID 135627264
methyl (4E)-4-hydroxy-4-[2-[6-[[(2E)-2-(1-hydroxy-4-methoxy-4-oxobutylidene)-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-4,4-dimethyl-6-oxocyclohexylidene]butanoate (PubChem CID 135627264) has the molecular formula C32H48N2O8 and a molecular weight of 588.74 g/mol. Its IUPAC name is methyl (4E)-4-hydroxy-4-[2-[6-[[(2E)-2-(1-hydroxy-4-methoxy-4-oxobutylidene)-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-4,4-dimethyl-6-oxocyclohexylidene]butanoate.
| Compound Name | methyl (4E)-4-hydroxy-4-[2-[6-[[(2E)-2-(1-hydroxy-4-methoxy-4-oxobutylidene)-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-4,4-dimethyl-6-oxocyclohexylidene]butanoate |
|---|---|
| PubChem CID | 135627264 |
| Molecular Formula | C32H48N2O8 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | methyl (4E)-4-hydroxy-4-[2-[6-[[(2E)-2-(1-hydroxy-4-methoxy-4-oxobutylidene)-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-4,4-dimethyl-6-oxocyclohexylidene]butanoate |
| SMILES | COC(=O)CC/C(O)=C1\C(=O)CC(C)(C)C\C1=N/CCCCCC/N=C1\CC(C)(C)CC(=O)\C1=C(\O)CCC(=O)OC |
| InChI | InChI=1S/C32H48N2O8/c1-31(2)17-21(29(25(37)19-31)23(35)11-13-27(39)41-5)33-15-9-7-8-10-16-34-22-18-32(3,4)20-26(38)30(22)24(36)12-14-28(40)42-6/h35-36H,7-20H2,1-6H3/b29-23+,30-24+,33-21+,34-22+ |
| InChIKey | WPSZUSOJXVFGOB-BSJFETEESA-N |
| XLogP | 5.74 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|