C19H25NO2 — CID 135466684
3-benzylimino-2-(1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 135466684) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-benzylimino-2-(1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one.
| Compound Name | 3-benzylimino-2-(1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135466684 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 3-benzylimino-2-(1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CCCC(O)=C1C(=O)CC(C)(C)C/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-4-8-16(21)18-15(11-19(2,3)12-17(18)22)20-13-14-9-6-5-7-10-14/h5-7,9-10,21H,4,8,11-13H2,1-3H3/b18-16?,20-15+ |
| InChIKey | SWEGZCSYHYMGRD-ALKJHRAUSA-N |
| XLogP | 4.63 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|