C22H25NO2 — CID 135400675
2-(1-hydroxybutylidene)-5,5-dimethyl-3-naphthalen-1-yliminocyclohexan-1-one (PubChem CID 135400675) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(1-hydroxybutylidene)-5,5-dimethyl-3-naphthalen-1-yliminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxybutylidene)-5,5-dimethyl-3-naphthalen-1-yliminocyclohexan-1-one |
|---|---|
| PubChem CID | 135400675 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-(1-hydroxybutylidene)-5,5-dimethyl-3-naphthalen-1-yliminocyclohexan-1-one |
| SMILES | CCCC(O)=C1C(=O)CC(C)(C)C/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C22H25NO2/c1-4-8-19(24)21-18(13-22(2,3)14-20(21)25)23-17-12-7-10-15-9-5-6-11-16(15)17/h5-7,9-12,24H,4,8,13-14H2,1-3H3/b21-19?,23-18+ |
| InChIKey | XSQYWJAOQXXQKK-KLGQWYLWSA-N |
| XLogP | 5.91 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|