C27H27NO2 — CID 135526135
3-benzylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 135526135) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-benzylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one.
| Compound Name | 3-benzylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135526135 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-benzylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(O)Cc2cccc3ccccc23)/C(=N/Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H27NO2/c1-27(2)16-23(28-18-19-9-4-3-5-10-19)26(25(30)17-27)24(29)15-21-13-8-12-20-11-6-7-14-22(20)21/h3-14,29H,15-18H2,1-2H3/b26-24?,28-23+ |
| InChIKey | LGSOFAVLLMKFPH-PSPBWOQKSA-N |
| XLogP | 6.22 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|