C19H24N2O4 — CID 135536194
2-(1-hydroxypentylidene)-5,5-dimethyl-3-(3-nitrophenyl)iminocyclohexan-1-one (PubChem CID 135536194) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(1-hydroxypentylidene)-5,5-dimethyl-3-(3-nitrophenyl)iminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxypentylidene)-5,5-dimethyl-3-(3-nitrophenyl)iminocyclohexan-1-one |
|---|---|
| PubChem CID | 135536194 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(1-hydroxypentylidene)-5,5-dimethyl-3-(3-nitrophenyl)iminocyclohexan-1-one |
| SMILES | CCCCC(O)=C1C(=O)CC(C)(C)C/C1=N\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N2O4/c1-4-5-9-16(22)18-15(11-19(2,3)12-17(18)23)20-13-7-6-8-14(10-13)21(24)25/h6-8,10,22H,4-5,9,11-12H2,1-3H3/b18-16?,20-15+ |
| InChIKey | QHCYIXKMKIDHPE-ALKJHRAUSA-N |
| XLogP | 5.06 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|