C21H26N2O6 — CID 135627423
3-[[(2E)-2-[1-hydroxy-3-(4-oxo-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid (PubChem CID 135627423) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[[(2E)-2-[1-hydroxy-3-(4-oxo-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid.
| Compound Name | 3-[[(2E)-2-[1-hydroxy-3-(4-oxo-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 135627423 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-[[(2E)-2-[1-hydroxy-3-(4-oxo-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoic acid |
| SMILES | CC1(C)CC(=O)C(=C(/O)CCc2noc3c2C(=O)CCC3)/C(=N/CCC(=O)O)C1 |
| InChI | InChI=1S/C21H26N2O6/c1-21(2)10-13(22-9-8-18(27)28)19(16(26)11-21)15(25)7-6-12-20-14(24)4-3-5-17(20)29-23-12/h25H,3-11H2,1-2H3,(H,27,28)/b19-15+,22-13+ |
| InChIKey | SEBHILNFUVLFFN-QANUSRJOSA-N |
| XLogP | 3.24 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|