About cis-(3S,5R)-3,5-diazidocyclohexan-1-one
cis-(3S,5R)-3,5-diazidocyclohexan-1-one (PubChem CID 118066035) has the molecular formula C6H8N6O
and a molecular weight of 180.17 g/mol. Its IUPAC name is cis-(3S,5R)-3,5-diazidocyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(3S,5R)-3,5-diazidocyclohexan-1-one |
| PubChem CID | 118066035 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | cis-(3S,5R)-3,5-diazidocyclohexan-1-one |
| SMILES | [N-]=[N+]=N[C@@H]1CC(=O)C[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C6H8N6O/c7-11-9-4-1-5(10-12-8)3-6(13)2-4/h4-5H,1-3H2/t4-,5+ |
| InChIKey | DMOZWBFTIYQHNM-SYDPRGILSA-N |
| XLogP | 2.10 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze cis-(3S,5R)-3,5-diazidocyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,5R)-3,5-diazidocyclohexan-1-one?
The IUPAC name of cis-(3S,5R)-3,5-diazidocyclohexan-1-one (CID 118066035) is cis-(3S,5R)-3,5-diazidocyclohexan-1-one.
What is the SMILES notation for cis-(3S,5R)-3,5-diazidocyclohexan-1-one?
The canonical SMILES for cis-(3S,5R)-3,5-diazidocyclohexan-1-one is [N-]=[N+]=N[C@@H]1CC(=O)C[C@H](N=[N+]=[N-])C1.
What is the InChIKey of cis-(3S,5R)-3,5-diazidocyclohexan-1-one?
The InChIKey is DMOZWBFTIYQHNM-SYDPRGILSA-N. The full InChI is InChI=1S/C6H8N6O/c7-11-9-4-1-5(10-12-8)3-6(13)2-4/h4-5H,1-3H2/t4-,5+.
What are the key properties of cis-(3S,5R)-3,5-diazidocyclohexan-1-one?
cis-(3S,5R)-3,5-diazidocyclohexan-1-one has a molecular weight of 180.17 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,5R)-3,5-diazidocyclohexan-1-one is sourced from PubChem (CID 118066035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).