C8H14F2N4 — CID 174763453
4-azido-3,3-difluoro-1-(2-methylpropyl)pyrrolidine (PubChem CID 174763453) has the molecular formula C8H14F2N4 and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-azido-3,3-difluoro-1-(2-methylpropyl)pyrrolidine.
| Compound Name | 4-azido-3,3-difluoro-1-(2-methylpropyl)pyrrolidine |
|---|---|
| PubChem CID | 174763453 |
| Molecular Formula | C8H14F2N4 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-azido-3,3-difluoro-1-(2-methylpropyl)pyrrolidine |
| SMILES | CC(C)CN1CC(N=[N+]=[N-])C(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N4/c1-6(2)3-14-4-7(12-13-11)8(9,10)5-14/h6-7H,3-5H2,1-2H3 |
| InChIKey | NUDLPIOVEXXISB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|